cas: 167684-02-8 — see every product listed under this CAS number, including other names
6-Ethoxy-2,3-difluorobenzaldehyde (CAS 167684-02-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F343393-5G |
| cas | 167684-02-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1622.36 Pln | |
| Fluorochem | 10g | 2700.11 Pln |
| delivery time | 3-4 weeks |
|---|
6-ethoxy-2,3-difluorobenzaldehyde (CAS 167684-02-8) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 6-ethoxy-2,3-difluorobenzaldehyde. InChIKey: AGFFKGUXHHUHOB-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 6-ethoxy-2,3-difluorobenzaldehyde |
| InChIKey | AGFFKGUXHHUHOB-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)F)F)C=O |
Computed by PubChem (NCBI)