6-Fluorobenzo[d]thiazole-2-carboxylic acid, 95%
cas: 479028-67-6 — see every product listed under this CAS number, including other names
6-Fluorobenzo[d]thiazole-2-carboxylic acid, 95% (CAS 479028-67-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A850450-250mg |
| cas | 479028-67-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1221.44 Pln | |
| Ambeed | 1g | 3168.31 Pln | |
| Chemat | 100mg | 674.00 Pln | |
| Chemat | 250mg | 1221.20 Pln | |
| Chemat | 1g | 3179.60 Pln | |
| BLDpharm | 100mg | 725.32 Pln | |
| BLDpharm | 250mg | 1314.01 Pln | |
| BLDpharm | 1g | 3407.71 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-fluoro-1,3-benzothiazole-2-carboxylic acid (CAS 479028-67-6) is a chemical compound with the molecular formula C8H4FNO2S and a molecular weight of 197.19 g/mol. IUPAC name: 6-fluoro-1,3-benzothiazole-2-carboxylic acid. InChIKey: ZKNFXQMRRWKBQB-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2S |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 6-fluoro-1,3-benzothiazole-2-carboxylic acid |
| InChIKey | ZKNFXQMRRWKBQB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)SC(=N2)C(=O)O |
Computed by PubChem (NCBI)