Products 139425-47-1
CAS 139425-47-1 is the registry number for 5-Fluorobenzo(d)thiazole-2-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
5-fluoro-1,3-benzothiazole-2-carboxylic acid (CAS 139425-47-1) is a chemical compound with the molecular formula C8H4FNO2S and a molecular weight of 197.19 g/mol. IUPAC name: 5-fluoro-1,3-benzothiazole-2-carboxylic acid. InChIKey: SZTWYWTZDUJKII-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2S |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 5-fluoro-1,3-benzothiazole-2-carboxylic acid |
| InChIKey | SZTWYWTZDUJKII-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)N=C(S2)C(=O)O |
Computed by PubChem (NCBI)