CAS 479028-70-1 appears in our catalog under these names: 4-Fluorobenzo(d)thiazole-2-carboxylic acid, 98%, 4-Fluorobenzo[d]thiazole-2-carboxylic acid, 98%, 98%, 4-Fluorobenzo[d]thiazole-2-carboxylic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
4-fluoro-1,3-benzothiazole-2-carboxylic acid (CAS 479028-70-1) is a chemical compound with the molecular formula C8H4FNO2S and a molecular weight of 197.19 g/mol. IUPAC name: 4-fluoro-1,3-benzothiazole-2-carboxylic acid. InChIKey: KFFJBGWTRIOOEN-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2S |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 4-fluoro-1,3-benzothiazole-2-carboxylic acid |
| InChIKey | KFFJBGWTRIOOEN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)SC(=N2)C(=O)O)F |
Computed by PubChem (NCBI)