Products 870235-46-4
CAS 870235-46-4 appears in our catalog under these names: 4–Fluorothieno(2，3–c)pyridine–2–carboxylic acid, 4-fluorothieno(2,3-c)pyridine-2-carboxylic acid, 4-Fluorothieno[2,3-c]pyridine-2-carboxylic acid, 95%, 95%, 4-FLUOROTHIENO[2,3-C]PYRIDINE-2-CARBOXYLIC ACID, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 5g.
4-fluorothieno[2,3-c]pyridine-2-carboxylic acid (CAS 870235-46-4) is a chemical compound with the molecular formula C8H4FNO2S and a molecular weight of 197.19 g/mol. IUPAC name: 4-fluorothieno[2,3-c]pyridine-2-carboxylic acid. InChIKey: HKXMBOHBJLYPJD-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2S |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 4-fluorothieno[2,3-c]pyridine-2-carboxylic acid |
| InChIKey | HKXMBOHBJLYPJD-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1C(=CN=C2)F)C(=O)O |
Computed by PubChem (NCBI)