CAS 1346817-42-2 is the registry number for 6-Fluorobenzo[d]thiazole-4-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-fluoro-1,3-benzothiazole-4-carboxylic acid (CAS 1346817-42-2) is a chemical compound with the molecular formula C8H4FNO2S and a molecular weight of 197.19 g/mol. IUPAC name: 6-fluoro-1,3-benzothiazole-4-carboxylic acid. InChIKey: GNGJOTROCBBLJP-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2S |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 6-fluoro-1,3-benzothiazole-4-carboxylic acid |
| InChIKey | GNGJOTROCBBLJP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1C(=O)O)N=CS2)F |
Computed by PubChem (NCBI)