Products 1346817-42-2

CAS 1346817-42-2 is the registry number for 6-Fluorobenzo[d]thiazole-4-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-fluoro-1,3-benzothiazole-4-carboxylic acid (CAS 1346817-42-2) is a chemical compound with the molecular formula C8H4FNO2S and a molecular weight of 197.19 g/mol. IUPAC name: 6-fluoro-1,3-benzothiazole-4-carboxylic acid. InChIKey: GNGJOTROCBBLJP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4FNO2S
Molecular weight197.19 g/mol
IUPAC name6-fluoro-1,3-benzothiazole-4-carboxylic acid
InChIKeyGNGJOTROCBBLJP-UHFFFAOYSA-N
SMILESC1=C(C=C2C(=C1C(=O)O)N=CS2)F

Computed by PubChem (NCBI)