cas: 128583-07-3 — see every product listed under this CAS number, including other names
6-Fluoropyridine-2-sulfonyl chloride, 97% (CAS 128583-07-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 500mg, 1g, 5g, 10g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A354418-250mg |
| cas | 128583-07-3 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 447.58 Pln | |
| AmBeed | 100mg | 382.48 Pln | |
| Fluorochem | 100mg | 414.46 Pln | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 500mg | 820.56 Pln | |
| Fluorochem | 1g | 1190.22 Pln | |
| Fluorochem | 5g | 3767.44 Pln | |
| Fluorochem | 10g | 6250.94 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-fluoropyridine-2-sulfonyl chloride (CAS 128583-07-3) is a chemical compound with the molecular formula C5H3ClFNO2S and a molecular weight of 195.60 g/mol. IUPAC name: 6-fluoropyridine-2-sulfonyl chloride. InChIKey: ZYYNYUDHGGZBOB-UHFFFAOYSA-N.
| Molecular formula | C5H3ClFNO2S |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 6-fluoropyridine-2-sulfonyl chloride |
| InChIKey | ZYYNYUDHGGZBOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)