cas: 71924-62-4 — see every product listed under this CAS number, including other names
6-Fluoroveratraldehyde, 97% (CAS 71924-62-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 398090010 |
| cas | 71924-62-4 |
| size | 1g |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 179.96 Pln | |
| Thermo Scientific (Acros) | 5g | 565.72 Pln | |
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 242.64 Pln | |
| Fluorochem | 5g | 461.31 Pln | |
| Fluorochem | 10g | 685.19 Pln | |
| Fluorochem | 25g | 1476.58 Pln | |
| Fluorochem | 100g | 5391.87 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2-fluoro-4,5-dimethoxybenzaldehyde (CAS 71924-62-4) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 2-fluoro-4,5-dimethoxybenzaldehyde. InChIKey: IBBYQNVXKFMSSI-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | 2-fluoro-4,5-dimethoxybenzaldehyde |
| InChIKey | IBBYQNVXKFMSSI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)F)OC |
Computed by PubChem (NCBI)