cas: 272785-31-6 — see every product listed under this CAS number, including other names
6-Formyl-3-hydroxy-2-methoxyphenyl acetate, 98%, 98% (CAS 272785-31-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DDZK-100mg |
| cas | 272785-31-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 746.00 Pln | |
| Chemat | 1g | 1581.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(6-formyl-3-hydroxy-2-methoxyphenyl) acetate (CAS 272785-31-6) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: (6-formyl-3-hydroxy-2-methoxyphenyl) acetate. InChIKey: LPIRKPUURBAMMR-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | (6-formyl-3-hydroxy-2-methoxyphenyl) acetate |
| InChIKey | LPIRKPUURBAMMR-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=CC(=C1OC)O)C=O |
Computed by PubChem (NCBI)