cas: 272785-31-6 — see every product listed under this CAS number, including other names
6-Formyl-3-hydroxy-2-methoxyphenyl acetate, 98% (CAS 272785-31-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F609700-100MG |
| cas | 272785-31-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 502.97 Pln | |
| Fluorochem | 250mg | 914.28 Pln | |
| Fluorochem | 1g | 1846.24 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(6-formyl-3-hydroxy-2-methoxyphenyl) acetate (CAS 272785-31-6) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: (6-formyl-3-hydroxy-2-methoxyphenyl) acetate. InChIKey: LPIRKPUURBAMMR-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | (6-formyl-3-hydroxy-2-methoxyphenyl) acetate |
| InChIKey | LPIRKPUURBAMMR-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=CC(=C1OC)O)C=O |
Computed by PubChem (NCBI)