CAS 4890-01-1 is the registry number for 6-Hydroxybenzo[d][1,3]dioxole-5-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-hydroxy-1,3-benzodioxole-5-carboxylic acid (CAS 4890-01-1) is a chemical compound with the molecular formula C8H6O5 and a molecular weight of 182.13 g/mol. IUPAC name: 6-hydroxy-1,3-benzodioxole-5-carboxylic acid. InChIKey: ZTARHDAAHPNGMF-UHFFFAOYSA-N.
| Molecular formula | C8H6O5 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 6-hydroxy-1,3-benzodioxole-5-carboxylic acid |
| InChIKey | ZTARHDAAHPNGMF-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)C(=O)O)O |
Computed by PubChem (NCBI)