cas: 49619-58-1 — see every product listed under this CAS number, including other names
6-Isopropyl-4-oxo-4H-chromene-3-carbaldehyde, 98%, 98% (CAS 49619-58-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 250mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114N02-1g |
| cas | 49619-58-1 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 25g | 467.60 Pln | |
| Chemat | 100g | 1403.60 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 10g | 222.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-oxo-6-propan-2-ylchromene-3-carbaldehyde (CAS 49619-58-1) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: 4-oxo-6-propan-2-ylchromene-3-carbaldehyde. InChIKey: FRRYMYQANNFABF-UHFFFAOYSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 4-oxo-6-propan-2-ylchromene-3-carbaldehyde |
| InChIKey | FRRYMYQANNFABF-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(C=C1)OC=C(C2=O)C=O |
Computed by PubChem (NCBI)