CAS 2224-00-2 appears in our catalog under these names: 2-Ethoxynaphthoic Acid, 2–ethoxy–1–naphthoic acid, 2-Ethoxy-1-naphthoic acid, 95%, 2-Ethoxy-1-naphthoic acid, ≥98%, 2-ethoxy-1-naphthoic acid, 98%, 98%. Offered by: Mikromol, GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 25mg, 100mg, 100g, 250g, 25g, 50g, 1g, 5g.
2-ethoxynaphthalene-1-carboxylic acid (CAS 2224-00-2) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: 2-ethoxynaphthalene-1-carboxylic acid. InChIKey: MYFBSSDLYGWAHH-UHFFFAOYSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 2-ethoxynaphthalene-1-carboxylic acid |
| InChIKey | MYFBSSDLYGWAHH-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C2=CC=CC=C2C=C1)C(=O)O |
Computed by PubChem (NCBI)