cas: 135-79-5 — see every product listed under this CAS number, including other names
6-Isopropylquinoline (CAS 135-79-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114N04-1g |
| cas | 135-79-5 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 736.40 Pln | |
| Fluorochem | 1g | 471.73 Pln |
| delivery time | 3 weeks |
|---|
6-propan-2-ylquinoline (CAS 135-79-5) is a chemical compound with the molecular formula C12H13N and a molecular weight of 171.24 g/mol. IUPAC name: 6-propan-2-ylquinoline. InChIKey: NKCQEIXYLHACJC-UHFFFAOYSA-N.
| Molecular formula | C12H13N |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | 6-propan-2-ylquinoline |
| InChIKey | NKCQEIXYLHACJC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(C=C1)N=CC=C2 |
Computed by PubChem (NCBI)