cas: 31910-18-6 — see every product listed under this CAS number, including other names
6-METHOXY-1,4-DIHYDROQUINOXALINE-2,3-DIONE, ≥97%, ≥97% (CAS 31910-18-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C8CJ-50mg |
| cas | 31910-18-6 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 347.60 Pln | |
| Chemat | 250mg | 770.00 Pln | |
| Chemat | 1g | 1480.40 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
6-methoxy-1,4-dihydroquinoxaline-2,3-dione (CAS 31910-18-6) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 6-methoxy-1,4-dihydroquinoxaline-2,3-dione. InChIKey: CHTYMWBYHAIEOF-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 6-methoxy-1,4-dihydroquinoxaline-2,3-dione |
| InChIKey | CHTYMWBYHAIEOF-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=O)C(=O)N2 |
Computed by PubChem (NCBI)