cas: 1263377-98-5 — see every product listed under this CAS number, including other names
6-Methoxy-1,2,3,4-tetrahydro-isoquinoline-1-carboxylic acid hydrochloride, 95%, 95% (CAS 1263377-98-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110VGX-100mg |
| cas | 1263377-98-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 717.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid;hydrochloride (CAS 1263377-98-5) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: 6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid;hydrochloride. InChIKey: UUWFHMARMBMUOJ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO3 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | 6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid;hydrochloride |
| InChIKey | UUWFHMARMBMUOJ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(NCC2)C(=O)O.Cl |
Computed by PubChem (NCBI)