Products 731815-67-1
CAS 731815-67-1 is the registry number for Methyl 5-(2-chloropropanoyl)-2,4-dimethyl-1h-pyrrole-3-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
Methyl 5-(2-chloropropanoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate (CAS 731815-67-1) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: methyl 5-(2-chloropropanoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate. InChIKey: DBNMDTVKDWABTM-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO3 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | methyl 5-(2-chloropropanoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| InChIKey | DBNMDTVKDWABTM-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=C1C(=O)OC)C)C(=O)C(C)Cl |
Computed by PubChem (NCBI)