Products 1826110-19-3
CAS 1826110-19-3 is the registry number for Ethyl 5-chloro-2-(propan-2-yloxy)pyridine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Ethyl 5-chloro-2-propan-2-yloxypyridine-3-carboxylate (CAS 1826110-19-3) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: ethyl 5-chloro-2-propan-2-yloxypyridine-3-carboxylate. InChIKey: JRLVAGNVFMBSRM-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO3 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | ethyl 5-chloro-2-propan-2-yloxypyridine-3-carboxylate |
| InChIKey | JRLVAGNVFMBSRM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=CC(=C1)Cl)OC(C)C |
Computed by PubChem (NCBI)