CAS 2413441-21-9 is the registry number for tert-Butyl 3-chloro-2-methoxyisonicotinate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
Tert-butyl 3-chloro-2-methoxypyridine-4-carboxylate (CAS 2413441-21-9) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: tert-butyl 3-chloro-2-methoxypyridine-4-carboxylate. InChIKey: OAPYUQCISGGVQC-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO3 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | tert-butyl 3-chloro-2-methoxypyridine-4-carboxylate |
| InChIKey | OAPYUQCISGGVQC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C(=NC=C1)OC)Cl |
Computed by PubChem (NCBI)