CAS 950-86-7 appears in our catalog under these names: 5-(2-Chloro-acetyl)-2,4-dimethyl-1h-pyrrole-3-carboxylic acid ethyl ester, 98%, Ethyl 5-(2-chloroacetyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 2,5g.
Ethyl 5-(2-chloroacetyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate (CAS 950-86-7) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: ethyl 5-(2-chloroacetyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate. InChIKey: GBOIWLVLZHQEEK-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO3 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | ethyl 5-(2-chloroacetyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| InChIKey | GBOIWLVLZHQEEK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C1C)C(=O)CCl)C |
Computed by PubChem (NCBI)