cas: 518990-36-8 — see every product listed under this CAS number, including other names
6-Methoxy-1H-indazole-3-carboxylic acid, 96%, 96% (CAS 518990-36-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0A8-100mg |
| cas | 518990-36-8 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 554.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
6-methoxy-1H-indazole-3-carboxylic acid (CAS 518990-36-8) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 6-methoxy-1H-indazole-3-carboxylic acid. InChIKey: NRJPGEXONZLCQP-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 6-methoxy-1H-indazole-3-carboxylic acid |
| InChIKey | NRJPGEXONZLCQP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)