cas: 42059-79-0 — see every product listed under this CAS number, including other names
6-Methoxy-3-formylchromone, 98% (CAS 42059-79-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F718077-100MG |
| cas | 42059-79-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 315.53 Pln | |
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 500mg | 570.65 Pln | |
| Fluorochem | 1g | 747.67 Pln | |
| Fluorochem | 2.5g | 1013.20 Pln | |
| Fluorochem | 5g | 1101.71 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-methoxy-4-oxochromene-3-carbaldehyde (CAS 42059-79-0) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 6-methoxy-4-oxochromene-3-carbaldehyde. InChIKey: ILFXSWVYDSZVBC-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 6-methoxy-4-oxochromene-3-carbaldehyde |
| InChIKey | ILFXSWVYDSZVBC-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OC=C(C2=O)C=O |
Computed by PubChem (NCBI)