CAS 4665-00-3 is the registry number for 3-(4-Methoxyphenyl)furan-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(4-methoxyphenyl)furan-2,5-dione (CAS 4665-00-3) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 3-(4-methoxyphenyl)furan-2,5-dione. InChIKey: SFKJHFOLVWLLBD-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)furan-2,5-dione |
| InChIKey | SFKJHFOLVWLLBD-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)OC2=O |
Computed by PubChem (NCBI)