cas: 23045-75-2 — see every product listed under this CAS number, including other names
6-Methoxy-3-methyl-benzo[b]thiophene-2-carboxylic acid, 96% (CAS 23045-75-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F737431-250MG |
| cas | 23045-75-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 2111.77 Pln | |
| Fluorochem | 1g | 4590.07 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
6-methoxy-3-methyl-1-benzothiophene-2-carboxylic acid (CAS 23045-75-2) is a chemical compound with the molecular formula C11H10O3S and a molecular weight of 222.26 g/mol. IUPAC name: 6-methoxy-3-methyl-1-benzothiophene-2-carboxylic acid. InChIKey: LMHFVTXBQQYWQO-UHFFFAOYSA-N.
| Molecular formula | C11H10O3S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | 6-methoxy-3-methyl-1-benzothiophene-2-carboxylic acid |
| InChIKey | LMHFVTXBQQYWQO-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C=CC(=C2)OC)C(=O)O |
Computed by PubChem (NCBI)