cas: 83732-72-3 — see every product listed under this CAS number, including other names
6-Methoxy-N2-methylpyridine-2,3-diamine dihydrochloride, 95% (CAS 83732-72-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A782984-10g |
| cas | 83732-72-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 10225.60 Pln | |
| AmBeed | 5g | 6163.36 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-methoxy-2-N-methylpyridine-2,3-diamine;dihydrochloride (CAS 83732-72-3) is a chemical compound with the molecular formula C7H13Cl2N3O and a molecular weight of 226.10 g/mol. IUPAC name: 6-methoxy-2-N-methylpyridine-2,3-diamine;dihydrochloride. InChIKey: GYLCRBBRGGGHBS-UHFFFAOYSA-N.
| Molecular formula | C7H13Cl2N3O |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 6-methoxy-2-N-methylpyridine-2,3-diamine;dihydrochloride |
| InChIKey | GYLCRBBRGGGHBS-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=CC(=N1)OC)N.Cl.Cl |
Computed by PubChem (NCBI)