CAS 1609406-47-4 appears in our catalog under these names: 1,4,5,6,7,8-Hexahydropyrazolo[3,4-d]azepin-3-ol dihydrochloride, 95%, 1H,4H,5H,6H,7H,8H-Pyrazolo(3,4-d)azepin-3-ol dihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 250mg, 1g, 2,5g.
2,4,5,6,7,8-hexahydro-1H-pyrazolo[3,4-d]azepin-3-one;dihydrochloride (CAS 1609406-47-4) is a chemical compound with the molecular formula C7H13Cl2N3O and a molecular weight of 226.10 g/mol. IUPAC name: 2,4,5,6,7,8-hexahydro-1H-pyrazolo[3,4-d]azepin-3-one;dihydrochloride. InChIKey: GDBMAABVFDZGKH-UHFFFAOYSA-N.
| Molecular formula | C7H13Cl2N3O |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 2,4,5,6,7,8-hexahydro-1H-pyrazolo[3,4-d]azepin-3-one;dihydrochloride |
| InChIKey | GDBMAABVFDZGKH-UHFFFAOYSA-N |
| SMILES | C1CNCCC2=C1C(=O)NN2.Cl.Cl |
Computed by PubChem (NCBI)