Products 1803607-83-1
CAS 1803607-83-1 appears in our catalog under these names: 1-(3-Aminopropyl)-1,2-dihydropyrimidin-2-one dihydrochloride, 1-(3-Aminopropyl)-1,2-dihydropyrimidin-2-one dihydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
1-(3-aminopropyl)pyrimidin-2-one;dihydrochloride (CAS 1803607-83-1) is a chemical compound with the molecular formula C7H13Cl2N3O and a molecular weight of 226.10 g/mol. IUPAC name: 1-(3-aminopropyl)pyrimidin-2-one;dihydrochloride. InChIKey: LJUKETJQSYPXFM-UHFFFAOYSA-N.
| Molecular formula | C7H13Cl2N3O |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 1-(3-aminopropyl)pyrimidin-2-one;dihydrochloride |
| InChIKey | LJUKETJQSYPXFM-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)N=C1)CCCN.Cl.Cl |
Computed by PubChem (NCBI)