CAS 83732-72-3 appears in our catalog under these names: 3-Amino-6-methoxy-2-(methylamino)pyridine dihydrochloride, 95%, 6-Methoxy-N2-methylpyridine-2,3-diamine Dihydrochloride, >95% (HPLC), 6-Methoxy-N2-methylpyridine-2,3-diamine dihydrochloride, 95%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 10mg, 50mg.
6-methoxy-2-N-methylpyridine-2,3-diamine;dihydrochloride (CAS 83732-72-3) is a chemical compound with the molecular formula C7H13Cl2N3O and a molecular weight of 226.10 g/mol. IUPAC name: 6-methoxy-2-N-methylpyridine-2,3-diamine;dihydrochloride. InChIKey: GYLCRBBRGGGHBS-UHFFFAOYSA-N.
| Molecular formula | C7H13Cl2N3O |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 6-methoxy-2-N-methylpyridine-2,3-diamine;dihydrochloride |
| InChIKey | GYLCRBBRGGGHBS-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=CC(=N1)OC)N.Cl.Cl |
Computed by PubChem (NCBI)