Products 1390654-29-1

CAS 1390654-29-1 is the registry number for 2-(2-Aminoethyl)-6-methyl-4-pyrimidinol dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(2-aminoethyl)-4-methyl-1H-pyrimidin-6-one;dihydrochloride (CAS 1390654-29-1) is a chemical compound with the molecular formula C7H13Cl2N3O and a molecular weight of 226.10 g/mol. IUPAC name: 2-(2-aminoethyl)-4-methyl-1H-pyrimidin-6-one;dihydrochloride. InChIKey: CBBAOLMVDMJTHR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13Cl2N3O
Molecular weight226.10 g/mol
IUPAC name2-(2-aminoethyl)-4-methyl-1H-pyrimidin-6-one;dihydrochloride
InChIKeyCBBAOLMVDMJTHR-UHFFFAOYSA-N
SMILESCC1=CC(=O)NC(=N1)CCN.Cl.Cl

Computed by PubChem (NCBI)