CAS 99199-69-6 appears in our catalog under these names: 6–Methoxychroman–2–carboxylic acid, 6-Methoxychroman-2-carboxylic acid, 6-Methoxychroman-2-carboxylic acid, 95%, 6-Methoxychroman-2-carboxylic acid, 97%, 6-Methoxychroman-2-carboxylic acid, 97%, 97%. Offered by: GLPBio, Biosynth, Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-methoxy-3,4-dihydro-2H-chromene-2-carboxylic acid (CAS 99199-69-6) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 6-methoxy-3,4-dihydro-2H-chromene-2-carboxylic acid. InChIKey: TYIMOLJFMUBRTB-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 6-methoxy-3,4-dihydro-2H-chromene-2-carboxylic acid |
| InChIKey | TYIMOLJFMUBRTB-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OC(CC2)C(=O)O |
Computed by PubChem (NCBI)