6-Nitro-[1,2,4]triazolo[1,5-a]pyridine, 95%
cas: 31040-14-9 — see every product listed under this CAS number, including other names
6-Nitro-[1,2,4]triazolo[1,5-a]pyridine, 95% (CAS 31040-14-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1046900-250mg |
| cas | 31040-14-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1026.75 Pln | |
| Ambeed | 1g | 2639.88 Pln | |
| Ambeed | 5g | 9064.56 Pln | |
| Chemat | 100mg | 664.40 Pln | |
| Chemat | 250mg | 1082.00 Pln | |
| Chemat | 1g | 2814.80 Pln | |
| Chemat | 5g | 9693.20 Pln | |
| BLDpharm | 100mg | 625.36 Pln | |
| BLDpharm | 250mg | 1003.00 Pln | |
| BLDpharm | 1g | 2591.33 Pln | |
| BLDpharm | 5g | 8889.12 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-nitro-[1,2,4]triazolo[1,5-a]pyridine (CAS 31040-14-9) is a chemical compound with the molecular formula C6H4N4O2 and a molecular weight of 164.12 g/mol. IUPAC name: 6-nitro-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: GIGSHORTMYGUNA-UHFFFAOYSA-N.
| Molecular formula | C6H4N4O2 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 6-nitro-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | GIGSHORTMYGUNA-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=NN2C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)