cas: 41959-35-7 — see every product listed under this CAS number, including other names
6-Nitro-1,2,3,4-tetrahydroquinoxaline, 98% (CAS 41959-35-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 250mg, 5g, 10g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A293143-1g |
| cas | 41959-35-7 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 486.64 Pln | |
| AmBeed | 25g | 4744.18 Pln | |
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 664.37 Pln | |
| Fluorochem | 10g | 1278.73 Pln | |
| Fluorochem | 25g | 2965.64 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-nitro-1,2,3,4-tetrahydroquinoxaline (CAS 41959-35-7) is a chemical compound with the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. IUPAC name: 6-nitro-1,2,3,4-tetrahydroquinoxaline. InChIKey: ZVDCYZVYRXZJQF-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O2 |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | 6-nitro-1,2,3,4-tetrahydroquinoxaline |
| InChIKey | ZVDCYZVYRXZJQF-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(N1)C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)