cas: 1571-85-3 — see every product listed under this CAS number, including other names
6-Nitro-2-phenyl-1H-benzo[d]imidazole, 95%, 95% (CAS 1571-85-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112P9I-100mg |
| cas | 1571-85-3 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 707.60 Pln | |
| Chemat | 10g | 1288.40 Pln | |
| Chemat | 25g | 2531.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-nitro-2-phenyl-1H-benzimidazole (CAS 1571-85-3) is a chemical compound with the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. IUPAC name: 6-nitro-2-phenyl-1H-benzimidazole. InChIKey: FHOXCSDDMCCTPM-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O2 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 6-nitro-2-phenyl-1H-benzimidazole |
| InChIKey | FHOXCSDDMCCTPM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(N2)C=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)