6-Phenoxybenzo[d]thiazol-2-amine, 95%
cas: 65948-19-8 — see every product listed under this CAS number, including other names
6-Phenoxybenzo[d]thiazol-2-amine, 95% (CAS 65948-19-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 500mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A138324-250mg |
| cas | 65948-19-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 570.62 Pln | |
| Ambeed | 5g | 1761.00 Pln | |
| Ambeed | 10g | 3057.06 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 616.40 Pln | |
| Chemat | 5g | 1643.60 Pln | |
| Chemat | 10g | 2776.40 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 614.25 Pln | |
| BLDpharm | 5g | 1897.13 Pln | |
| BLDpharm | 10g | 3291.09 Pln | |
| Fluorochem | 250mg | 492.55 Pln | |
| Fluorochem | 1g | 1132.95 Pln | |
| Fluorochem | 5g | 3059.36 Pln | |
| Fluorochem | 10g | 5141.96 Pln | |
| Fluorochem | 500mg | 700.81 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-phenoxy-1,3-benzothiazol-2-amine (CAS 65948-19-8) is a chemical compound with the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. IUPAC name: 6-phenoxy-1,3-benzothiazol-2-amine. InChIKey: AGCIBKULIKCGAH-UHFFFAOYSA-N.
| Molecular formula | C13H10N2OS |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 6-phenoxy-1,3-benzothiazol-2-amine |
| InChIKey | AGCIBKULIKCGAH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC3=C(C=C2)N=C(S3)N |
Computed by PubChem (NCBI)