CAS 35978-38-2 appears in our catalog under these names: 6-Methyl-5-phenylthieno[2,3-d]pyrimidin-4(3h)-one, 95%, 6-Methyl-5-phenylthieno(2,3-d)pyrimidin-4(3H)-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g.
6-methyl-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 35978-38-2) is a chemical compound with the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. IUPAC name: 6-methyl-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: RKCANXOFEMKLEZ-UHFFFAOYSA-N.
| Molecular formula | C13H10N2OS |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 6-methyl-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | RKCANXOFEMKLEZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(S1)N=CNC2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)