CAS 1778-82-1 is the registry number for Cyamemazine Impurity 3. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
10H-phenothiazine-2-carboxamide (CAS 1778-82-1) is a chemical compound with the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. IUPAC name: 10H-phenothiazine-2-carboxamide. InChIKey: KETFITVSYVFHLU-UHFFFAOYSA-N.
| Molecular formula | C13H10N2OS |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 10H-phenothiazine-2-carboxamide |
| InChIKey | KETFITVSYVFHLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=C(S2)C=CC(=C3)C(=O)N |
Computed by PubChem (NCBI)