CAS 439692-62-3 is the registry number for 6-Benzylthieno[2,3-d]pyrimidin-4(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-benzyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 439692-62-3) is a chemical compound with the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. IUPAC name: 6-benzyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: AMKYLVMEADPURC-UHFFFAOYSA-N.
| Molecular formula | C13H10N2OS |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 6-benzyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | AMKYLVMEADPURC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC3=C(S2)N=CNC3=O |
Computed by PubChem (NCBI)