cas: 78831-00-2 — see every product listed under this CAS number, including other names
6-Phenyl-4,5-dihydro-1,2,4-triazin-3(2H)-one, 95+% (CAS 78831-00-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A403340-1g |
| cas | 78831-00-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 6163.36 Pln | |
| AmBeed | 25g | 54910.24 Pln | |
| AmBeed | 5g | 18350.08 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-phenyl-4,5-dihydro-2H-1,2,4-triazin-3-one (CAS 78831-00-2) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 6-phenyl-4,5-dihydro-2H-1,2,4-triazin-3-one. InChIKey: LWMREWHCHKZSDF-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 6-phenyl-4,5-dihydro-2H-1,2,4-triazin-3-one |
| InChIKey | LWMREWHCHKZSDF-UHFFFAOYSA-N |
| SMILES | C1C(=NNC(=O)N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)