CAS 78831-00-2 appears in our catalog under these names: 6-Phenyl-2,3,4,5-tetrahydro-1,2,4-triazin-3-one, 95%, 6-Phenyl-4,5-dihydro-1,2,4-triazin-3(2H)-one, 95+%, 6–Phenyl–4,5–dihydro–1,2,4–triazin–3(2H)–one. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
6-phenyl-4,5-dihydro-2H-1,2,4-triazin-3-one (CAS 78831-00-2) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 6-phenyl-4,5-dihydro-2H-1,2,4-triazin-3-one. InChIKey: LWMREWHCHKZSDF-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 6-phenyl-4,5-dihydro-2H-1,2,4-triazin-3-one |
| InChIKey | LWMREWHCHKZSDF-UHFFFAOYSA-N |
| SMILES | C1C(=NNC(=O)N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)