CAS 76635-31-9 appears in our catalog under these names: 4-(3-Methyl-1,2,4-oxadiazol-5-yl)aniline, 95%, 4-(3-Methyl-1,2,4-oxadiazol-5-yl)aniline, 98+%, 4–(3–methyl–1,2,4–oxadiazol–5–yl)aniline. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 250mg, 1g.
4-(3-methyl-1,2,4-oxadiazol-5-yl)aniline (CAS 76635-31-9) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 4-(3-methyl-1,2,4-oxadiazol-5-yl)aniline. InChIKey: SLXBJYRWWOPAOU-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 4-(3-methyl-1,2,4-oxadiazol-5-yl)aniline |
| InChIKey | SLXBJYRWWOPAOU-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)