CAS 31803-00-6 appears in our catalog under these names: 5-Benzyl-1,3,4-oxadiazol-2-ylamine, 95%, 5-Benzyl-1,3,4-oxadiazol-2-amine, 97%, 5-Benzyl-1,3,4-oxadiazol-2ylamine. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 1g.
5-benzyl-1,3,4-oxadiazol-2-amine (CAS 31803-00-6) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 5-benzyl-1,3,4-oxadiazol-2-amine. InChIKey: UEHXUDSFIIVUNO-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 5-benzyl-1,3,4-oxadiazol-2-amine |
| InChIKey | UEHXUDSFIIVUNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NN=C(O2)N |
Computed by PubChem (NCBI)