CAS 116836-27-2 appears in our catalog under these names: 2-Amino-8-methylquinazolin-4(3H)-one, 98%, 2-Amino-8-methyl-3,4-dihydroquinazolin-4-one, 96%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 10g, 250mg.
2-amino-8-methyl-3H-quinazolin-4-one (CAS 116836-27-2) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 2-amino-8-methyl-3H-quinazolin-4-one. InChIKey: NLLZAHIPYDRNRQ-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 2-amino-8-methyl-3H-quinazolin-4-one |
| InChIKey | NLLZAHIPYDRNRQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)