CAS 29051-44-3 appears in our catalog under these names: 6-Phenylpyridine-3-carboxylic Acid, >98.0%(GC), 6–Phenylnicotinic acid, 6-Phenylnicotinic acid, 95% , 6-phenylnicotinic acid, 97%, 97%, 6-Phenylnicotinic acid, 97%. Offered by: TCI, GLPBio, Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250MG, 10g, 25g.
6-phenylpyridine-3-carboxylic acid (CAS 29051-44-3) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 6-phenylpyridine-3-carboxylic acid. InChIKey: DLFLQXUYRFIFOK-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 6-phenylpyridine-3-carboxylic acid |
| InChIKey | DLFLQXUYRFIFOK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)