cas: 240400-95-7 — see every product listed under this CAS number, including other names
6-bromo-1,4-dichlorophthalazine, 98%, 98% (CAS 240400-95-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C4WF-100mg |
| cas | 240400-95-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 2267.60 Pln | |
| Chemat | 10g | 4197.20 Pln | |
| Chemat | 25g | 6952.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-bromo-1,4-dichlorophthalazine (CAS 240400-95-7) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 6-bromo-1,4-dichlorophthalazine. InChIKey: MRUUOENIWOPHLR-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 6-bromo-1,4-dichlorophthalazine |
| InChIKey | MRUUOENIWOPHLR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)