cas: 4138-19-6 — see every product listed under this CAS number, including other names
6-tert-butyl-2-oxo-1,2-dihydropyridine-3-carbonitrile, 98% (CAS 4138-19-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F848169-100MG |
| cas | 4138-19-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 471.73 Pln | |
| Fluorochem | 250mg | 737.26 Pln | |
| Fluorochem | 500mg | 1263.11 Pln | |
| Fluorochem | 1g | 1539.06 Pln | |
| Fluorochem | 5g | 5745.91 Pln | |
| Fluorochem | 10g | 11431.41 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-tert-butyl-2-oxo-1H-pyridine-3-carbonitrile (CAS 4138-19-6) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 6-tert-butyl-2-oxo-1H-pyridine-3-carbonitrile. InChIKey: GQRGMRVSJVMBMH-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 6-tert-butyl-2-oxo-1H-pyridine-3-carbonitrile |
| InChIKey | GQRGMRVSJVMBMH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C(=O)N1)C#N |
Computed by PubChem (NCBI)