cas: 1142193-11-0 — see every product listed under this CAS number, including other names
7,8-Difluoro-4-hydroxyquinoline, 98%, 98% (CAS 1142193-11-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1104HO-250mg |
| cas | 1142193-11-0 |
| size | 250mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 520.40 Pln | |
| Chemat | 1g | 1182.80 Pln | |
| Chemat | 100mg | 333.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7,8-difluoro-1H-quinolin-4-one (CAS 1142193-11-0) is a chemical compound with the molecular formula C9H5F2NO and a molecular weight of 181.14 g/mol. IUPAC name: 7,8-difluoro-1H-quinolin-4-one. InChIKey: FCMOETXRLDHWLW-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO |
|---|---|
| Molecular weight | 181.14 g/mol |
| IUPAC name | 7,8-difluoro-1H-quinolin-4-one |
| InChIKey | FCMOETXRLDHWLW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)C=CN2)F)F |
Computed by PubChem (NCBI)