7,8-difluoro-1,4-dihydroquinolin-4-one, 98%
cas: 1142193-11-0 — see every product listed under this CAS number, including other names
7,8-difluoro-1,4-dihydroquinolin-4-one, 98% (CAS 1142193-11-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F954142-100MG |
| cas | 1142193-11-0 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 627.92 Pln | |
| Fluorochem | 1g | 1440.14 Pln | |
| Fluorochem | 5g | 2887.54 Pln | |
| Fluorochem | 10g | 4871.22 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
7,8-difluoro-1H-quinolin-4-one (CAS 1142193-11-0) is a chemical compound with the molecular formula C9H5F2NO and a molecular weight of 181.14 g/mol. IUPAC name: 7,8-difluoro-1H-quinolin-4-one. InChIKey: FCMOETXRLDHWLW-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO |
|---|---|
| Molecular weight | 181.14 g/mol |
| IUPAC name | 7,8-difluoro-1H-quinolin-4-one |
| InChIKey | FCMOETXRLDHWLW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)C=CN2)F)F |
Computed by PubChem (NCBI)