cas: 40528-04-9 — see every product listed under this CAS number, including other names
7,9-Dichloro-2,3-dihydro-1H-cyclopenta[b]quinoline, 97% (CAS 40528-04-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F626912-250MG |
| cas | 40528-04-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1695.25 Pln | |
| Fluorochem | 500mg | 2497.06 Pln | |
| Fluorochem | 1g | 3746.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
7,9-dichloro-2,3-dihydro-1H-cyclopenta[b]quinoline (CAS 40528-04-9) is a chemical compound with the molecular formula C12H9Cl2N and a molecular weight of 238.11 g/mol. IUPAC name: 7,9-dichloro-2,3-dihydro-1H-cyclopenta[b]quinoline. InChIKey: DSAXMSKPQOLUOU-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2N |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 7,9-dichloro-2,3-dihydro-1H-cyclopenta[b]quinoline |
| InChIKey | DSAXMSKPQOLUOU-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=C(C=CC(=C3)Cl)N=C2C1)Cl |
Computed by PubChem (NCBI)