CAS 58597-03-8 is the registry number for 3-Benzyl-2,6-dichloropyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
3-benzyl-2,6-dichloropyridine (CAS 58597-03-8) is a chemical compound with the molecular formula C12H9Cl2N and a molecular weight of 238.11 g/mol. IUPAC name: 3-benzyl-2,6-dichloropyridine. InChIKey: QONBWWCOWVHQGK-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2N |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 3-benzyl-2,6-dichloropyridine |
| InChIKey | QONBWWCOWVHQGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(N=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)