Products 58597-03-8

CAS 58597-03-8 is the registry number for 3-Benzyl-2,6-dichloropyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-benzyl-2,6-dichloropyridine (CAS 58597-03-8) is a chemical compound with the molecular formula C12H9Cl2N and a molecular weight of 238.11 g/mol. IUPAC name: 3-benzyl-2,6-dichloropyridine. InChIKey: QONBWWCOWVHQGK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9Cl2N
Molecular weight238.11 g/mol
IUPAC name3-benzyl-2,6-dichloropyridine
InChIKeyQONBWWCOWVHQGK-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC2=C(N=C(C=C2)Cl)Cl

Computed by PubChem (NCBI)