CAS 939757-52-5 is the registry number for 2',4'-Dichloro-[1,1'-biphenyl]-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(2,4-dichlorophenyl)aniline (CAS 939757-52-5) is a chemical compound with the molecular formula C12H9Cl2N and a molecular weight of 238.11 g/mol. IUPAC name: 4-(2,4-dichlorophenyl)aniline. InChIKey: JOEYVWJDOFQLJM-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2N |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 4-(2,4-dichlorophenyl)aniline |
| InChIKey | JOEYVWJDOFQLJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)Cl)Cl)N |
Computed by PubChem (NCBI)